C26H32N2O3 — CID 134829282
(3S,5Z,8S,11R)-3,12-dimethyl-8-phenyl-11-propan-2-yl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione (PubChem CID 134829282) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is (3S,5Z,8S,11R)-3,12-dimethyl-8-phenyl-11-propan-2-yl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione.
| Compound Name | (3S,5Z,8S,11R)-3,12-dimethyl-8-phenyl-11-propan-2-yl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione |
|---|---|
| PubChem CID | 134829282 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | (3S,5Z,8S,11R)-3,12-dimethyl-8-phenyl-11-propan-2-yl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione |
| SMILES | CC(C)[C@@H]1C(=O)N[C@H](c2ccccc2)C/C=C\C[C@H](C)Oc2ccccc2C(=O)N1C |
| InChI | InChI=1S/C26H32N2O3/c1-18(2)24-25(29)27-22(20-13-6-5-7-14-20)16-10-8-12-19(3)31-23-17-11-9-15-21(23)26(30)28(24)4/h5-11,13-15,17-19,22,24H,12,16H2,1-4H3,(H,27,29)/b10-8-/t19-,22-,24+/m0/s1 |
| InChIKey | VBTCZVOMCIVAGU-OWGHQKHVSA-N |
| XLogP | 4.76 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|