C20H20BrFN2O2 — CID 134829704
[(3aS,4R,9bR)-8-bromo-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-(4-fluorophenyl)methanone (PubChem CID 134829704) has the molecular formula C20H20BrFN2O2 and a molecular weight of 419.29 g/mol. Its IUPAC name is [(3aS,4R,9bR)-8-bromo-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-(4-fluorophenyl)methanone.
| Compound Name | [(3aS,4R,9bR)-8-bromo-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 134829704 |
| Molecular Formula | C20H20BrFN2O2 |
| Molecular Weight | 419.29 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | [(3aS,4R,9bR)-8-bromo-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-(4-fluorophenyl)methanone |
| SMILES | CN1c2ccc(Br)cc2[C@H]2[C@H](CCN2C(=O)c2ccc(F)cc2)[C@@H]1CO |
| InChI | InChI=1S/C20H20BrFN2O2/c1-23-17-7-4-13(21)10-16(17)19-15(18(23)11-25)8-9-24(19)20(26)12-2-5-14(22)6-3-12/h2-7,10,15,18-19,25H,8-9,11H2,1H3/t15-,18+,19-/m1/s1 |
| InChIKey | ISQXQAWAXZZFSD-AYOQOUSVSA-N |
| XLogP | 3.60 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |