C26H26FN3O2 — CID 134829725
1-[(3aR,4S,9bS)-8-(2-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-2-pyridin-2-ylethanone (PubChem CID 134829725) has the molecular formula C26H26FN3O2 and a molecular weight of 431.51 g/mol. Its IUPAC name is 1-[(3aR,4S,9bS)-8-(2-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-2-pyridin-2-ylethanone.
| Compound Name | 1-[(3aR,4S,9bS)-8-(2-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-2-pyridin-2-ylethanone |
|---|---|
| PubChem CID | 134829725 |
| Molecular Formula | C26H26FN3O2 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 1-[(3aR,4S,9bS)-8-(2-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-2-pyridin-2-ylethanone |
| SMILES | CN1c2ccc(-c3ccccc3F)cc2[C@@H]2[C@@H](CCN2C(=O)Cc2ccccn2)[C@H]1CO |
| InChI | InChI=1S/C26H26FN3O2/c1-29-23-10-9-17(19-7-2-3-8-22(19)27)14-21(23)26-20(24(29)16-31)11-13-30(26)25(32)15-18-6-4-5-12-28-18/h2-10,12,14,20,24,26,31H,11,13,15-16H2,1H3/t20-,24+,26-/m0/s1 |
| InChIKey | KVGREMBJHWKQAV-KHMOSXFSSA-N |
| XLogP | 3.83 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |