C26H30FN3O2 — CID 134829785
(3aS,4R,9bR)-8-(cyclohexen-1-yl)-N-(4-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide (PubChem CID 134829785) has the molecular formula C26H30FN3O2 and a molecular weight of 435.54 g/mol. Its IUPAC name is (3aS,4R,9bR)-8-(cyclohexen-1-yl)-N-(4-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide.
| Compound Name | (3aS,4R,9bR)-8-(cyclohexen-1-yl)-N-(4-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide |
|---|---|
| PubChem CID | 134829785 |
| Molecular Formula | C26H30FN3O2 |
| Molecular Weight | 435.54 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | (3aS,4R,9bR)-8-(cyclohexen-1-yl)-N-(4-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide |
| SMILES | CN1c2ccc(C3=CCCCC3)cc2[C@H]2[C@H](CCN2C(=O)Nc2ccc(F)cc2)[C@@H]1CO |
| InChI | InChI=1S/C26H30FN3O2/c1-29-23-12-7-18(17-5-3-2-4-6-17)15-22(23)25-21(24(29)16-31)13-14-30(25)26(32)28-20-10-8-19(27)9-11-20/h5,7-12,15,21,24-25,31H,2-4,6,13-14,16H2,1H3,(H,28,32)/t21-,24+,25-/m1/s1 |
| InChIKey | KGULNRRGRNBHOX-IEZKXTBUSA-N |
| XLogP | 5.19 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.54 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|