C26H27FN2O4S — CID 134829800
[(3aS,4S,9bS)-8-(2-fluorophenyl)-1-(2-methoxyphenyl)sulfonyl-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-4-yl]methanol (PubChem CID 134829800) has the molecular formula C26H27FN2O4S and a molecular weight of 482.58 g/mol. Its IUPAC name is [(3aS,4S,9bS)-8-(2-fluorophenyl)-1-(2-methoxyphenyl)sulfonyl-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-4-yl]methanol.
| Compound Name | [(3aS,4S,9bS)-8-(2-fluorophenyl)-1-(2-methoxyphenyl)sulfonyl-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-4-yl]methanol |
|---|---|
| PubChem CID | 134829800 |
| Molecular Formula | C26H27FN2O4S |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | [(3aS,4S,9bS)-8-(2-fluorophenyl)-1-(2-methoxyphenyl)sulfonyl-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-4-yl]methanol |
| SMILES | COc1ccccc1S(=O)(=O)N1CC[C@H]2[C@@H](CO)N(C)c3ccc(-c4ccccc4F)cc3[C@H]21 |
| InChI | InChI=1S/C26H27FN2O4S/c1-28-22-12-11-17(18-7-3-4-8-21(18)27)15-20(22)26-19(23(28)16-30)13-14-29(26)34(31,32)25-10-6-5-9-24(25)33-2/h3-12,15,19,23,26,30H,13-14,16H2,1-2H3/t19-,23+,26-/m0/s1 |
| InChIKey | YFYUTUPGBXPAJX-CNPGNWEMSA-N |
| XLogP | 4.06 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |