C24H31N3O3 — CID 134829867
(3aR,4S,9bS)-4-(hydroxymethyl)-8-(4-methoxyphenyl)-5-methyl-N-propan-2-yl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide (PubChem CID 134829867) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is (3aR,4S,9bS)-4-(hydroxymethyl)-8-(4-methoxyphenyl)-5-methyl-N-propan-2-yl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide.
| Compound Name | (3aR,4S,9bS)-4-(hydroxymethyl)-8-(4-methoxyphenyl)-5-methyl-N-propan-2-yl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide |
|---|---|
| PubChem CID | 134829867 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | (3aR,4S,9bS)-4-(hydroxymethyl)-8-(4-methoxyphenyl)-5-methyl-N-propan-2-yl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinoline-1-carboxamide |
| SMILES | COc1ccc(-c2ccc3c(c2)[C@@H]2[C@@H](CCN2C(=O)NC(C)C)[C@@H](CO)N3C)cc1 |
| InChI | InChI=1S/C24H31N3O3/c1-15(2)25-24(29)27-12-11-19-22(14-28)26(3)21-10-7-17(13-20(21)23(19)27)16-5-8-18(30-4)9-6-16/h5-10,13,15,19,22-23,28H,11-12,14H2,1-4H3,(H,25,29)/t19-,22+,23-/m0/s1 |
| InChIKey | IDGQQXFKIOSAER-PMOQBDJRSA-N |
| XLogP | 3.65 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |