C9H12O2 — CID 13482988
1,3,4,7,8,8a-hexahydroisochromen-6-one (PubChem CID 13482988) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 1,3,4,7,8,8a-hexahydroisochromen-6-one.
| Compound Name | 1,3,4,7,8,8a-hexahydroisochromen-6-one |
|---|---|
| PubChem CID | 13482988 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 1,3,4,7,8,8a-hexahydroisochromen-6-one |
| SMILES | O=C1C=C2CCOCC2CC1 |
| InChI | InChI=1S/C9H12O2/c10-9-2-1-8-6-11-4-3-7(8)5-9/h5,8H,1-4,6H2 |
| InChIKey | VVTXBQICDZEGQP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |