About 4-piperazin-1-ylfuro[3,2-c]pyridine;dihydrochloride
4-piperazin-1-ylfuro[3,2-c]pyridine;dihydrochloride (PubChem CID 134830355) has the molecular formula C11H15Cl2N3O
and a molecular weight of 276.17 g/mol. Its IUPAC name is 4-piperazin-1-ylfuro[3,2-c]pyridine;dihydrochloride.
Molecular Properties
| Compound Name | 4-piperazin-1-ylfuro[3,2-c]pyridine;dihydrochloride |
| PubChem CID | 134830355 |
| Molecular Formula | C11H15Cl2N3O |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 4-piperazin-1-ylfuro[3,2-c]pyridine;dihydrochloride |
| SMILES | Cl.Cl.c1cc2occc2c(N2CCNCC2)n1 |
| InChI | InChI=1S/C11H13N3O.2ClH/c1-3-13-11(9-2-8-15-10(1)9)14-6-4-12-5-7-14;;/h1-3,8,12H,4-7H2;2*1H |
| InChIKey | VZKMUGPYMLNDIX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-piperazin-1-ylfuro[3,2-c]pyridine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperazin-1-ylfuro[3,2-c]pyridine;dihydrochloride?
The IUPAC name of 4-piperazin-1-ylfuro[3,2-c]pyridine;dihydrochloride (CID 134830355) is 4-piperazin-1-ylfuro[3,2-c]pyridine;dihydrochloride.
What is the SMILES notation for 4-piperazin-1-ylfuro[3,2-c]pyridine;dihydrochloride?
The canonical SMILES for 4-piperazin-1-ylfuro[3,2-c]pyridine;dihydrochloride is Cl.Cl.c1cc2occc2c(N2CCNCC2)n1.
What is the InChIKey of 4-piperazin-1-ylfuro[3,2-c]pyridine;dihydrochloride?
The InChIKey is VZKMUGPYMLNDIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O.2ClH/c1-3-13-11(9-2-8-15-10(1)9)14-6-4-12-5-7-14;;/h1-3,8,12H,4-7H2;2*1H.
What are the key properties of 4-piperazin-1-ylfuro[3,2-c]pyridine;dihydrochloride?
4-piperazin-1-ylfuro[3,2-c]pyridine;dihydrochloride has a molecular weight of 276.17 g/mol, XLogP of 2.08, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperazin-1-ylfuro[3,2-c]pyridine;dihydrochloride is sourced from PubChem (CID 134830355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).