C15H18O3 — CID 134830494
(8E)-5-methyl-4-oxatricyclo[10.2.1.02,11]pentadeca-8,13-diene-3,10-dione (PubChem CID 134830494) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (8E)-5-methyl-4-oxatricyclo[10.2.1.02,11]pentadeca-8,13-diene-3,10-dione.
| Compound Name | (8E)-5-methyl-4-oxatricyclo[10.2.1.02,11]pentadeca-8,13-diene-3,10-dione |
|---|---|
| PubChem CID | 134830494 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (8E)-5-methyl-4-oxatricyclo[10.2.1.02,11]pentadeca-8,13-diene-3,10-dione |
| SMILES | CC1CC/C=C/C(=O)C2C3C=CC(C3)C2C(=O)O1 |
| InChI | InChI=1S/C15H18O3/c1-9-4-2-3-5-12(16)13-10-6-7-11(8-10)14(13)15(17)18-9/h3,5-7,9-11,13-14H,2,4,8H2,1H3/b5-3+ |
| InChIKey | KYDOXUXGAKOFST-HWKANZROSA-N |
| XLogP | 2.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|