C13H7F7O2 — CID 134830531
2-(1,1,2,2,3,3,3-heptafluoropropyl)-7-methylchromen-4-one (PubChem CID 134830531) has the molecular formula C13H7F7O2 and a molecular weight of 328.18 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,3-heptafluoropropyl)-7-methylchromen-4-one.
| Compound Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-7-methylchromen-4-one |
|---|---|
| PubChem CID | 134830531 |
| Molecular Formula | C13H7F7O2 |
| Molecular Weight | 328.18 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 2-(1,1,2,2,3,3,3-heptafluoropropyl)-7-methylchromen-4-one |
| SMILES | Cc1ccc2c(=O)cc(C(F)(F)C(F)(F)C(F)(F)F)oc2c1 |
| InChI | InChI=1S/C13H7F7O2/c1-6-2-3-7-8(21)5-10(22-9(7)4-6)11(14,15)12(16,17)13(18,19)20/h2-5H,1H3 |
| InChIKey | BRNBOOCZJAOXQV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.18 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|