C18H34O7 — CID 134830572
methyl (2S)-2-[(2S,5R)-5-[(2S)-5,5-diethoxy-2-hydroxypentan-2-yl]-2-ethyloxolan-2-yl]-2-hydroxyacetate (PubChem CID 134830572) has the molecular formula C18H34O7 and a molecular weight of 362.46 g/mol. Its IUPAC name is methyl (2S)-2-[(2S,5R)-5-[(2S)-5,5-diethoxy-2-hydroxypentan-2-yl]-2-ethyloxolan-2-yl]-2-hydroxyacetate.
| Compound Name | methyl (2S)-2-[(2S,5R)-5-[(2S)-5,5-diethoxy-2-hydroxypentan-2-yl]-2-ethyloxolan-2-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 134830572 |
| Molecular Formula | C18H34O7 |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | methyl (2S)-2-[(2S,5R)-5-[(2S)-5,5-diethoxy-2-hydroxypentan-2-yl]-2-ethyloxolan-2-yl]-2-hydroxyacetate |
| SMILES | CCOC(CC[C@](C)(O)[C@H]1CC[C@@](CC)([C@H](O)C(=O)OC)O1)OCC |
| InChI | InChI=1S/C18H34O7/c1-6-18(15(19)16(20)22-5)12-9-13(25-18)17(4,21)11-10-14(23-7-2)24-8-3/h13-15,19,21H,6-12H2,1-5H3/t13-,15-,17+,18+/m1/s1 |
| InChIKey | IEEYBZGTWMTNJO-WCZJQEMASA-N |
| XLogP | 1.78 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|