C23H24Cl3NO6 — CID 134830588
[(2S,5R)-3,5-bis(phenylmethoxy)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl] acetate (PubChem CID 134830588) has the molecular formula C23H24Cl3NO6 and a molecular weight of 516.81 g/mol. Its IUPAC name is [(2S,5R)-3,5-bis(phenylmethoxy)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl] acetate.
| Compound Name | [(2S,5R)-3,5-bis(phenylmethoxy)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl] acetate |
|---|---|
| PubChem CID | 134830588 |
| Molecular Formula | C23H24Cl3NO6 |
| Molecular Weight | 516.81 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | [(2S,5R)-3,5-bis(phenylmethoxy)-2-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl] acetate |
| SMILES | [H]/N=C(/O[C@@H]1OC[C@@H](OCc2ccccc2)C(OC(C)=O)C1OCc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C23H24Cl3NO6/c1-15(28)32-19-18(29-12-16-8-4-2-5-9-16)14-31-21(33-22(27)23(24,25)26)20(19)30-13-17-10-6-3-7-11-17/h2-11,18-21,27H,12-14H2,1H3/b27-22+/t18-,19?,20?,21+/m1/s1 |
| InChIKey | DNOBRFKWJIJASH-XSLYUSNLSA-N |
| XLogP | 4.81 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.81 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|