C16H20O4S — CID 134830590
9-(benzenesulfonyl)-2-methyl-2,3,4,5,8,9-hexahydrooxecin-10-one (PubChem CID 134830590) has the molecular formula C16H20O4S and a molecular weight of 308.40 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-2-methyl-2,3,4,5,8,9-hexahydrooxecin-10-one.
| Compound Name | 9-(benzenesulfonyl)-2-methyl-2,3,4,5,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 134830590 |
| Molecular Formula | C16H20O4S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 9-(benzenesulfonyl)-2-methyl-2,3,4,5,8,9-hexahydrooxecin-10-one |
| SMILES | CC1CCCC=CCC(S(=O)(=O)c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C16H20O4S/c1-13-9-5-2-3-8-12-15(16(17)20-13)21(18,19)14-10-6-4-7-11-14/h3-4,6-8,10-11,13,15H,2,5,9,12H2,1H3 |
| InChIKey | WKSSMHDALUYLEV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|