C24H50O2Si2 — CID 134830594
tert-butyl-[(4E,8E)-12-[tert-butyl(dimethyl)silyl]oxydodeca-4,8-dienoxy]-dimethylsilane (PubChem CID 134830594) has the molecular formula C24H50O2Si2 and a molecular weight of 426.83 g/mol. Its IUPAC name is tert-butyl-[(4E,8E)-12-[tert-butyl(dimethyl)silyl]oxydodeca-4,8-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(4E,8E)-12-[tert-butyl(dimethyl)silyl]oxydodeca-4,8-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134830594 |
| Molecular Formula | C24H50O2Si2 |
| Molecular Weight | 426.83 g/mol |
| Exact Mass | 426.33 |
| IUPAC Name | tert-butyl-[(4E,8E)-12-[tert-butyl(dimethyl)silyl]oxydodeca-4,8-dienoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCC/C=C/CC/C=C/CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H50O2Si2/c1-23(2,3)27(7,8)25-21-19-17-15-13-11-12-14-16-18-20-22-26-28(9,10)24(4,5)6/h13-16H,11-12,17-22H2,1-10H3/b15-13+,16-14+ |
| InChIKey | XTENZSXYOVCNGV-WXUKJITCSA-N |
| XLogP | 8.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.83 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|