C24H52O5Si2 — CID 134830595
(1S)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2S,5R)-5-[(1R)-4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxybutyl]oxolan-2-yl]butan-1-ol (PubChem CID 134830595) has the molecular formula C24H52O5Si2 and a molecular weight of 476.85 g/mol. Its IUPAC name is (1S)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2S,5R)-5-[(1R)-4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxybutyl]oxolan-2-yl]butan-1-ol.
| Compound Name | (1S)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2S,5R)-5-[(1R)-4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxybutyl]oxolan-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 134830595 |
| Molecular Formula | C24H52O5Si2 |
| Molecular Weight | 476.85 g/mol |
| Exact Mass | 476.34 |
| IUPAC Name | (1S)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2S,5R)-5-[(1R)-4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxybutyl]oxolan-2-yl]butan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCCC[C@@H](O)[C@H]1CC[C@@H]([C@@H](O)CCCO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C24H52O5Si2/c1-23(2,3)30(7,8)27-17-11-13-19(25)21-15-16-22(29-21)20(26)14-12-18-28-31(9,10)24(4,5)6/h19-22,25-26H,11-18H2,1-10H3/t19-,20+,21-,22+ |
| InChIKey | UWXZUYCIZDVMIP-COPRSSIGSA-N |
| XLogP | 5.86 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.85 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|