C22H40O6Si — CID 134830610
[(E,2R)-6-ethoxy-6-oxohex-4-en-2-yl] (E,5S,7R)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxyoct-2-enoate (PubChem CID 134830610) has the molecular formula C22H40O6Si and a molecular weight of 428.64 g/mol. Its IUPAC name is [(E,2R)-6-ethoxy-6-oxohex-4-en-2-yl] (E,5S,7R)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxyoct-2-enoate.
| Compound Name | [(E,2R)-6-ethoxy-6-oxohex-4-en-2-yl] (E,5S,7R)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxyoct-2-enoate |
|---|---|
| PubChem CID | 134830610 |
| Molecular Formula | C22H40O6Si |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | [(E,2R)-6-ethoxy-6-oxohex-4-en-2-yl] (E,5S,7R)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxyoct-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@@H](C)OC(=O)/C=C/C[C@@H](C[C@@H](C)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40O6Si/c1-9-26-20(24)14-10-12-18(3)27-21(25)15-11-13-19(16-17(2)23)28-29(7,8)22(4,5)6/h10-11,14-15,17-19,23H,9,12-13,16H2,1-8H3/b14-10+,15-11+/t17-,18-,19+/m1/s1 |
| InChIKey | DXBJWOVUBYBAQL-LWBLMGSESA-N |
| XLogP | 4.54 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|