C16H24O6S — CID 134830619
2-[[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]methoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 134830619) has the molecular formula C16H24O6S and a molecular weight of 344.43 g/mol. Its IUPAC name is 2-[[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]methoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]methoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134830619 |
| Molecular Formula | C16H24O6S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-[[(4S)-2,2,4-trimethyl-1,3-dioxolan-4-yl]methoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOC[C@@]2(C)COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C16H24O6S/c1-13-5-7-14(8-6-13)23(17,18)21-10-9-19-11-16(4)12-20-15(2,3)22-16/h5-8H,9-12H2,1-4H3/t16-/m0/s1 |
| InChIKey | WOCBSUCYUBPGAE-INIZCTEOSA-N |
| XLogP | 2.26 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|