C18H28O5 — CID 134830662
(6aS)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-6,6-bis(prop-2-enyl)-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole (PubChem CID 134830662) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is (6aS)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-6,6-bis(prop-2-enyl)-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole.
| Compound Name | (6aS)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-6,6-bis(prop-2-enyl)-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 134830662 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (6aS)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-6,6-bis(prop-2-enyl)-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole |
| SMILES | C=CCC1(CC=C)C(C2COC(C)(C)O2)OC2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C18H28O5/c1-7-9-18(10-8-2)13(12-11-19-16(3,4)21-12)20-15-14(18)22-17(5,6)23-15/h7-8,12-15H,1-2,9-11H2,3-6H3/t12?,13?,14-,15?/m1/s1 |
| InChIKey | BGLWUVJNJAGABO-MIGSVPMKSA-N |
| XLogP | 3.15 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|