C10H17NO — CID 134830691
4-[(3Z)-3-methylpenta-1,3-dien-2-yl]morpholine (PubChem CID 134830691) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 4-[(3Z)-3-methylpenta-1,3-dien-2-yl]morpholine.
| Compound Name | 4-[(3Z)-3-methylpenta-1,3-dien-2-yl]morpholine |
|---|---|
| PubChem CID | 134830691 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 4-[(3Z)-3-methylpenta-1,3-dien-2-yl]morpholine |
| SMILES | C=C(/C(C)=C\C)N1CCOCC1 |
| InChI | InChI=1S/C10H17NO/c1-4-9(2)10(3)11-5-7-12-8-6-11/h4H,3,5-8H2,1-2H3/b9-4- |
| InChIKey | CCCJHPIIZSMOJU-WTKPLQERSA-N |
| XLogP | 1.80 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|