About 5-cyclopenta-1,3-dien-1-yl-7,7-dimethoxybicyclo[2.2.1]hept-2-ene
5-cyclopenta-1,3-dien-1-yl-7,7-dimethoxybicyclo[2.2.1]hept-2-ene (PubChem CID 134830770) has the molecular formula C14H17O2-
and a molecular weight of 217.29 g/mol. Its IUPAC name is 5-cyclopenta-1,3-dien-1-yl-7,7-dimethoxybicyclo[2.2.1]hept-2-ene.
Molecular Properties
| Compound Name | 5-cyclopenta-1,3-dien-1-yl-7,7-dimethoxybicyclo[2.2.1]hept-2-ene |
| PubChem CID | 134830770 |
| Molecular Formula | C14H17O2- |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 5-cyclopenta-1,3-dien-1-yl-7,7-dimethoxybicyclo[2.2.1]hept-2-ene |
| SMILES | COC1(OC)C2C=CC1C(c1ccc[cH-]1)C2 |
| InChI | InChI=1S/C14H17O2/c1-15-14(16-2)11-7-8-13(14)12(9-11)10-5-3-4-6-10/h3-8,11-13H,9H2,1-2H3/q-1 |
| InChIKey | IHUBANUNMQAKPH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclopenta-1,3-dien-1-yl-7,7-dimethoxybicyclo[2.2.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopenta-1,3-dien-1-yl-7,7-dimethoxybicyclo[2.2.1]hept-2-ene?
The IUPAC name of 5-cyclopenta-1,3-dien-1-yl-7,7-dimethoxybicyclo[2.2.1]hept-2-ene (CID 134830770) is 5-cyclopenta-1,3-dien-1-yl-7,7-dimethoxybicyclo[2.2.1]hept-2-ene.
What is the SMILES notation for 5-cyclopenta-1,3-dien-1-yl-7,7-dimethoxybicyclo[2.2.1]hept-2-ene?
The canonical SMILES for 5-cyclopenta-1,3-dien-1-yl-7,7-dimethoxybicyclo[2.2.1]hept-2-ene is COC1(OC)C2C=CC1C(c1ccc[cH-]1)C2.
What is the InChIKey of 5-cyclopenta-1,3-dien-1-yl-7,7-dimethoxybicyclo[2.2.1]hept-2-ene?
The InChIKey is IHUBANUNMQAKPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17O2/c1-15-14(16-2)11-7-8-13(14)12(9-11)10-5-3-4-6-10/h3-8,11-13H,9H2,1-2H3/q-1.
What are the key properties of 5-cyclopenta-1,3-dien-1-yl-7,7-dimethoxybicyclo[2.2.1]hept-2-ene?
5-cyclopenta-1,3-dien-1-yl-7,7-dimethoxybicyclo[2.2.1]hept-2-ene has a molecular weight of 217.29 g/mol, XLogP of 2.68, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopenta-1,3-dien-1-yl-7,7-dimethoxybicyclo[2.2.1]hept-2-ene is sourced from PubChem (CID 134830770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).