About [(2R,5S)-3,4-diacetyloxy-5-prop-2-enyloxolan-2-yl]methyl acetate
[(2R,5S)-3,4-diacetyloxy-5-prop-2-enyloxolan-2-yl]methyl acetate (PubChem CID 134830803) has the molecular formula C14H20O7
and a molecular weight of 300.31 g/mol. Its IUPAC name is [(2R,5S)-3,4-diacetyloxy-5-prop-2-enyloxolan-2-yl]methyl acetate.
Molecular Properties
| Compound Name | [(2R,5S)-3,4-diacetyloxy-5-prop-2-enyloxolan-2-yl]methyl acetate |
| PubChem CID | 134830803 |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | [(2R,5S)-3,4-diacetyloxy-5-prop-2-enyloxolan-2-yl]methyl acetate |
| SMILES | C=CC[C@@H]1O[C@H](COC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C14H20O7/c1-5-6-11-13(19-9(3)16)14(20-10(4)17)12(21-11)7-18-8(2)15/h5,11-14H,1,6-7H2,2-4H3/t11-,12+,13?,14?/m0/s1 |
| InChIKey | UVIHTBFXQVYMAR-MRFVTOPCSA-N |
| XLogP | 0.76 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2R,5S)-3,4-diacetyloxy-5-prop-2-enyloxolan-2-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,5S)-3,4-diacetyloxy-5-prop-2-enyloxolan-2-yl]methyl acetate?
The IUPAC name of [(2R,5S)-3,4-diacetyloxy-5-prop-2-enyloxolan-2-yl]methyl acetate (CID 134830803) is [(2R,5S)-3,4-diacetyloxy-5-prop-2-enyloxolan-2-yl]methyl acetate.
What is the SMILES notation for [(2R,5S)-3,4-diacetyloxy-5-prop-2-enyloxolan-2-yl]methyl acetate?
The canonical SMILES for [(2R,5S)-3,4-diacetyloxy-5-prop-2-enyloxolan-2-yl]methyl acetate is C=CC[C@@H]1O[C@H](COC(C)=O)C(OC(C)=O)C1OC(C)=O.
What is the InChIKey of [(2R,5S)-3,4-diacetyloxy-5-prop-2-enyloxolan-2-yl]methyl acetate?
The InChIKey is UVIHTBFXQVYMAR-MRFVTOPCSA-N. The full InChI is InChI=1S/C14H20O7/c1-5-6-11-13(19-9(3)16)14(20-10(4)17)12(21-11)7-18-8(2)15/h5,11-14H,1,6-7H2,2-4H3/t11-,12+,13?,14?/m0/s1.
What are the key properties of [(2R,5S)-3,4-diacetyloxy-5-prop-2-enyloxolan-2-yl]methyl acetate?
[(2R,5S)-3,4-diacetyloxy-5-prop-2-enyloxolan-2-yl]methyl acetate has a molecular weight of 300.31 g/mol, XLogP of 0.76, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,5S)-3,4-diacetyloxy-5-prop-2-enyloxolan-2-yl]methyl acetate is sourced from PubChem (CID 134830803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).