C17H21NO2 — CID 134830858
(E)-5-[(3R,5R)-3-phenyl-2,3,5,6,7,7a-hexahydropyrrolo[2,1-b][1,3]oxazol-5-yl]pent-3-en-2-one (PubChem CID 134830858) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is (E)-5-[(3R,5R)-3-phenyl-2,3,5,6,7,7a-hexahydropyrrolo[2,1-b][1,3]oxazol-5-yl]pent-3-en-2-one.
| Compound Name | (E)-5-[(3R,5R)-3-phenyl-2,3,5,6,7,7a-hexahydropyrrolo[2,1-b][1,3]oxazol-5-yl]pent-3-en-2-one |
|---|---|
| PubChem CID | 134830858 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (E)-5-[(3R,5R)-3-phenyl-2,3,5,6,7,7a-hexahydropyrrolo[2,1-b][1,3]oxazol-5-yl]pent-3-en-2-one |
| SMILES | CC(=O)/C=C/C[C@H]1CCC2OC[C@@H](c3ccccc3)N21 |
| InChI | InChI=1S/C17H21NO2/c1-13(19)6-5-9-15-10-11-17-18(15)16(12-20-17)14-7-3-2-4-8-14/h2-8,15-17H,9-12H2,1H3/b6-5+/t15-,16-,17?/m0/s1 |
| InChIKey | VAUDQEXFVOULCG-KHKQPWALSA-N |
| XLogP | 3.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|