C18H15NO4 — CID 134830941
6-(2-phenylethyl)-8H-[1,3]dioxolo[4,5-g]isoquinoline-5,7-dione (PubChem CID 134830941) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is 6-(2-phenylethyl)-8H-[1,3]dioxolo[4,5-g]isoquinoline-5,7-dione.
| Compound Name | 6-(2-phenylethyl)-8H-[1,3]dioxolo[4,5-g]isoquinoline-5,7-dione |
|---|---|
| PubChem CID | 134830941 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 6-(2-phenylethyl)-8H-[1,3]dioxolo[4,5-g]isoquinoline-5,7-dione |
| SMILES | O=C1Cc2cc3c(cc2C(=O)N1CCc1ccccc1)OCO3 |
| InChI | InChI=1S/C18H15NO4/c20-17-9-13-8-15-16(23-11-22-15)10-14(13)18(21)19(17)7-6-12-4-2-1-3-5-12/h1-5,8,10H,6-7,9,11H2 |
| InChIKey | WRPHWYHAKFGTLI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|