C34H41N3O7S — CID 134831160
(2S,5R)-5-azido-6-methyl-2-[(3S,6S)-2-methyl-6-methylsulfanyl-3,5-bis(phenylmethoxy)oxan-4-yl]oxy-4-phenylmethoxyoxan-3-ol (PubChem CID 134831160) has the molecular formula C34H41N3O7S and a molecular weight of 635.78 g/mol. Its IUPAC name is (2S,5R)-5-azido-6-methyl-2-[(3S,6S)-2-methyl-6-methylsulfanyl-3,5-bis(phenylmethoxy)oxan-4-yl]oxy-4-phenylmethoxyoxan-3-ol.
| Compound Name | (2S,5R)-5-azido-6-methyl-2-[(3S,6S)-2-methyl-6-methylsulfanyl-3,5-bis(phenylmethoxy)oxan-4-yl]oxy-4-phenylmethoxyoxan-3-ol |
|---|---|
| PubChem CID | 134831160 |
| Molecular Formula | C34H41N3O7S |
| Molecular Weight | 635.78 g/mol |
| Exact Mass | 635.27 |
| IUPAC Name | (2S,5R)-5-azido-6-methyl-2-[(3S,6S)-2-methyl-6-methylsulfanyl-3,5-bis(phenylmethoxy)oxan-4-yl]oxy-4-phenylmethoxyoxan-3-ol |
| SMILES | CS[C@@H]1OC(C)[C@H](OCc2ccccc2)C(O[C@@H]2OC(C)[C@@H](N=[N+]=[N-])C(OCc3ccccc3)C2O)C1OCc1ccccc1 |
| InChI | InChI=1S/C34H41N3O7S/c1-22-27(36-37-35)30(40-20-25-15-9-5-10-16-25)28(38)33(42-22)44-31-29(39-19-24-13-7-4-8-14-24)23(2)43-34(45-3)32(31)41-21-26-17-11-6-12-18-26/h4-18,22-23,27-34,38H,19-21H2,1-3H3/t22?,23?,27-,28?,29+,30?,31?,32?,33+,34+/m1/s1 |
| InChIKey | PKUCTWAZLKATQB-IJBOFFQXSA-N |
| XLogP | 6.02 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.78 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|