C15H14N2S2 — CID 134831226
benzyl (NZ)-N-[amino(phenyl)methylidene]carbamodithioate (PubChem CID 134831226) has the molecular formula C15H14N2S2 and a molecular weight of 286.43 g/mol. Its IUPAC name is benzyl (NZ)-N-[amino(phenyl)methylidene]carbamodithioate.
| Compound Name | benzyl (NZ)-N-[amino(phenyl)methylidene]carbamodithioate |
|---|---|
| PubChem CID | 134831226 |
| Molecular Formula | C15H14N2S2 |
| Molecular Weight | 286.43 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | benzyl (NZ)-N-[amino(phenyl)methylidene]carbamodithioate |
| SMILES | N/C(=N\C(=S)SCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H14N2S2/c16-14(13-9-5-2-6-10-13)17-15(18)19-11-12-7-3-1-4-8-12/h1-10H,11H2,(H2,16,17,18) |
| InChIKey | KZWUFVFOYNTANW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|