C18H30O3Si2 — CID 134831241
[(3E)-1-methoxy-4-(4-methylphenyl)-3-trimethylsilyloxybuta-1,3-dienoxy]-trimethylsilane (PubChem CID 134831241) has the molecular formula C18H30O3Si2 and a molecular weight of 350.61 g/mol. Its IUPAC name is [(3E)-1-methoxy-4-(4-methylphenyl)-3-trimethylsilyloxybuta-1,3-dienoxy]-trimethylsilane.
| Compound Name | [(3E)-1-methoxy-4-(4-methylphenyl)-3-trimethylsilyloxybuta-1,3-dienoxy]-trimethylsilane |
|---|---|
| PubChem CID | 134831241 |
| Molecular Formula | C18H30O3Si2 |
| Molecular Weight | 350.61 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | [(3E)-1-methoxy-4-(4-methylphenyl)-3-trimethylsilyloxybuta-1,3-dienoxy]-trimethylsilane |
| SMILES | COC(=C/C(=C\c1ccc(C)cc1)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C18H30O3Si2/c1-15-9-11-16(12-10-15)13-17(20-22(3,4)5)14-18(19-2)21-23(6,7)8/h9-14H,1-8H3/b17-13+,18-14? |
| InChIKey | ITHUSQBKLBSPIU-QOPSANPBSA-N |
| XLogP | 5.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.61 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|