C22H38O2Si2 — CID 134831305
(3aE,6E,9aS)-5-butyl-3-methyl-6-trimethylsilyl-2-trimethylsilyloxy-1,5,9,9a-tetrahydrocyclopenta[8]annulen-8-one (PubChem CID 134831305) has the molecular formula C22H38O2Si2 and a molecular weight of 390.72 g/mol. Its IUPAC name is (3aE,6E,9aS)-5-butyl-3-methyl-6-trimethylsilyl-2-trimethylsilyloxy-1,5,9,9a-tetrahydrocyclopenta[8]annulen-8-one.
| Compound Name | (3aE,6E,9aS)-5-butyl-3-methyl-6-trimethylsilyl-2-trimethylsilyloxy-1,5,9,9a-tetrahydrocyclopenta[8]annulen-8-one |
|---|---|
| PubChem CID | 134831305 |
| Molecular Formula | C22H38O2Si2 |
| Molecular Weight | 390.72 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (3aE,6E,9aS)-5-butyl-3-methyl-6-trimethylsilyl-2-trimethylsilyloxy-1,5,9,9a-tetrahydrocyclopenta[8]annulen-8-one |
| SMILES | CCCCC1/C=C2/C(C)=C(O[Si](C)(C)C)C[C@H]2CC(=O)/C=C\1[Si](C)(C)C |
| InChI | InChI=1S/C22H38O2Si2/c1-9-10-11-17-13-20-16(2)21(24-26(6,7)8)14-18(20)12-19(23)15-22(17)25(3,4)5/h13,15,17-18H,9-12,14H2,1-8H3/b20-13-,22-15+/t17?,18-/m1/s1 |
| InChIKey | NQSNZLAUOMXTMT-HCIMUSEWSA-N |
| XLogP | 6.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.72 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|