About benzyl N-benzyl-N-[(2S,3S)-1,3-bis(phenylmethoxy)hex-5-en-2-yl]carbamate
benzyl N-benzyl-N-[(2S,3S)-1,3-bis(phenylmethoxy)hex-5-en-2-yl]carbamate (PubChem CID 134831456) has the molecular formula C35H37NO4
and a molecular weight of 535.68 g/mol. Its IUPAC name is benzyl N-benzyl-N-[(2S,3S)-1,3-bis(phenylmethoxy)hex-5-en-2-yl]carbamate.
Molecular Properties
| Compound Name | benzyl N-benzyl-N-[(2S,3S)-1,3-bis(phenylmethoxy)hex-5-en-2-yl]carbamate |
| PubChem CID | 134831456 |
| Molecular Formula | C35H37NO4 |
| Molecular Weight | 535.68 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | benzyl N-benzyl-N-[(2S,3S)-1,3-bis(phenylmethoxy)hex-5-en-2-yl]carbamate |
| SMILES | C=CC[C@H](OCc1ccccc1)[C@H](COCc1ccccc1)N(Cc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H37NO4/c1-2-15-34(39-26-31-20-11-5-12-21-31)33(28-38-25-30-18-9-4-10-19-30)36(24-29-16-7-3-8-17-29)35(37)40-27-32-22-13-6-14-23-32/h2-14,16-23,33-34H,1,15,24-28H2/t33-,34-/m0/s1 |
| InChIKey | DARAAMHGBKXTIK-HEVIKAOCSA-N |
| XLogP | 7.57 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 535.68 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-benzyl-N-[(2S,3S)-1,3-bis(phenylmethoxy)hex-5-en-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-benzyl-N-[(2S,3S)-1,3-bis(phenylmethoxy)hex-5-en-2-yl]carbamate?
The IUPAC name of benzyl N-benzyl-N-[(2S,3S)-1,3-bis(phenylmethoxy)hex-5-en-2-yl]carbamate (CID 134831456) is benzyl N-benzyl-N-[(2S,3S)-1,3-bis(phenylmethoxy)hex-5-en-2-yl]carbamate.
What is the SMILES notation for benzyl N-benzyl-N-[(2S,3S)-1,3-bis(phenylmethoxy)hex-5-en-2-yl]carbamate?
The canonical SMILES for benzyl N-benzyl-N-[(2S,3S)-1,3-bis(phenylmethoxy)hex-5-en-2-yl]carbamate is C=CC[C@H](OCc1ccccc1)[C@H](COCc1ccccc1)N(Cc1ccccc1)C(=O)OCc1ccccc1.
What is the InChIKey of benzyl N-benzyl-N-[(2S,3S)-1,3-bis(phenylmethoxy)hex-5-en-2-yl]carbamate?
The InChIKey is DARAAMHGBKXTIK-HEVIKAOCSA-N. The full InChI is InChI=1S/C35H37NO4/c1-2-15-34(39-26-31-20-11-5-12-21-31)33(28-38-25-30-18-9-4-10-19-30)36(24-29-16-7-3-8-17-29)35(37)40-27-32-22-13-6-14-23-32/h2-14,16-23,33-34H,1,15,24-28H2/t33-,34-/m0/s1.
What are the key properties of benzyl N-benzyl-N-[(2S,3S)-1,3-bis(phenylmethoxy)hex-5-en-2-yl]carbamate?
benzyl N-benzyl-N-[(2S,3S)-1,3-bis(phenylmethoxy)hex-5-en-2-yl]carbamate has a molecular weight of 535.68 g/mol, XLogP of 7.57, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-benzyl-N-[(2S,3S)-1,3-bis(phenylmethoxy)hex-5-en-2-yl]carbamate is sourced from PubChem (CID 134831456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).