C30H41NO3Si — CID 134831608
(2S)-1-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1,2-diphenylethyl]-3-hydroxy-2-methyl-2,3,4,6,7,8-hexahydroquinolin-5-one (PubChem CID 134831608) has the molecular formula C30H41NO3Si and a molecular weight of 491.75 g/mol. Its IUPAC name is (2S)-1-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1,2-diphenylethyl]-3-hydroxy-2-methyl-2,3,4,6,7,8-hexahydroquinolin-5-one.
| Compound Name | (2S)-1-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1,2-diphenylethyl]-3-hydroxy-2-methyl-2,3,4,6,7,8-hexahydroquinolin-5-one |
|---|---|
| PubChem CID | 134831608 |
| Molecular Formula | C30H41NO3Si |
| Molecular Weight | 491.75 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | (2S)-1-[(1S,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1,2-diphenylethyl]-3-hydroxy-2-methyl-2,3,4,6,7,8-hexahydroquinolin-5-one |
| SMILES | C[C@H]1C(O)CC2=C(CCCC2=O)N1[C@@H](c1ccccc1)[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C30H41NO3Si/c1-21-27(33)20-24-25(18-13-19-26(24)32)31(21)28(22-14-9-7-10-15-22)29(23-16-11-8-12-17-23)34-35(5,6)30(2,3)4/h7-12,14-17,21,27-29,33H,13,18-20H2,1-6H3/t21-,27?,28-,29+/m0/s1 |
| InChIKey | XABNVURHSJSROD-SGEAEUEOSA-N |
| XLogP | 6.95 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.75 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|