C38H39N3O5 — CID 134831632
ethyl (3S)-2-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]-1-(2-methylprop-1-enyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 134831632) has the molecular formula C38H39N3O5 and a molecular weight of 617.75 g/mol. Its IUPAC name is ethyl (3S)-2-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]-1-(2-methylprop-1-enyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | ethyl (3S)-2-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]-1-(2-methylprop-1-enyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 134831632 |
| Molecular Formula | C38H39N3O5 |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 617.29 |
| IUPAC Name | ethyl (3S)-2-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]-1-(2-methylprop-1-enyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1Cc2c([nH]c3ccccc23)C(C=C(C)C)N1C(=O)[C@@H]1CCCN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C38H39N3O5/c1-4-45-37(43)34-21-29-28-16-9-10-17-31(28)39-35(29)33(20-23(2)3)41(34)36(42)32-18-11-19-40(32)38(44)46-22-30-26-14-7-5-12-24(26)25-13-6-8-15-27(25)30/h5-10,12-17,20,30,32-34,39H,4,11,18-19,21-22H2,1-3H3/t32-,33?,34-/m0/s1 |
| InChIKey | JYHCMQNQOQWQAC-ICUIMKRYSA-N |
| XLogP | 6.91 |
| TPSA | 91.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|