C32H40O6Si — CID 134831710
(3R,4R,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-(methoxymethoxymethyl)-3-phenylmethoxyoxolan-2-one (PubChem CID 134831710) has the molecular formula C32H40O6Si and a molecular weight of 548.75 g/mol. Its IUPAC name is (3R,4R,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-(methoxymethoxymethyl)-3-phenylmethoxyoxolan-2-one.
| Compound Name | (3R,4R,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-(methoxymethoxymethyl)-3-phenylmethoxyoxolan-2-one |
|---|---|
| PubChem CID | 134831710 |
| Molecular Formula | C32H40O6Si |
| Molecular Weight | 548.75 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | (3R,4R,5S)-5-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-4-(methoxymethoxymethyl)-3-phenylmethoxyoxolan-2-one |
| SMILES | COCOC[C@@H]1[C@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)OC(=O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C32H40O6Si/c1-32(2,3)39(26-16-10-6-11-17-26,27-18-12-7-13-19-27)37-21-20-29-28(23-35-24-34-4)30(31(33)38-29)36-22-25-14-8-5-9-15-25/h5-19,28-30H,20-24H2,1-4H3/t28-,29+,30-/m1/s1 |
| InChIKey | KCCJBRWYZGFQKA-DYIKCSJPSA-N |
| XLogP | 4.70 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.75 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|