C38H55O8PSi — CID 134831744
tert-butyl-[(2S,5R)-2-(diethoxyphosphorylmethyl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]oxy-dimethylsilane (PubChem CID 134831744) has the molecular formula C38H55O8PSi and a molecular weight of 698.91 g/mol. Its IUPAC name is tert-butyl-[(2S,5R)-2-(diethoxyphosphorylmethyl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,5R)-2-(diethoxyphosphorylmethyl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134831744 |
| Molecular Formula | C38H55O8PSi |
| Molecular Weight | 698.91 g/mol |
| Exact Mass | 698.34 |
| IUPAC Name | tert-butyl-[(2S,5R)-2-(diethoxyphosphorylmethyl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]oxy-dimethylsilane |
| SMILES | CCOP(=O)(C[C@H]1OC(COCc2ccccc2)[C@@H](OCc2ccccc2)C(OCc2ccccc2)C1O[Si](C)(C)C(C)(C)C)OCC |
| InChI | InChI=1S/C38H55O8PSi/c1-8-43-47(39,44-9-2)29-34-36(46-48(6,7)38(3,4)5)37(42-27-32-23-17-12-18-24-32)35(41-26-31-21-15-11-16-22-31)33(45-34)28-40-25-30-19-13-10-14-20-30/h10-24,33-37H,8-9,25-29H2,1-7H3/t33?,34-,35-,36?,37?/m1/s1 |
| InChIKey | UPXNBWIOGDVNLP-VABIYMCKSA-N |
| XLogP | 8.80 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.91 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|