C35H49NO15 — CID 134831804
[(3S,6S)-6-[(2S,3S,6R)-5-acetamido-2-(phenylmethoxymethyl)-4-prop-2-enoxy-6-propoxyoxan-3-yl]oxy-3,4,5-triacetyloxyoxan-2-yl]methyl acetate (PubChem CID 134831804) has the molecular formula C35H49NO15 and a molecular weight of 723.77 g/mol. Its IUPAC name is [(3S,6S)-6-[(2S,3S,6R)-5-acetamido-2-(phenylmethoxymethyl)-4-prop-2-enoxy-6-propoxyoxan-3-yl]oxy-3,4,5-triacetyloxyoxan-2-yl]methyl acetate.
| Compound Name | [(3S,6S)-6-[(2S,3S,6R)-5-acetamido-2-(phenylmethoxymethyl)-4-prop-2-enoxy-6-propoxyoxan-3-yl]oxy-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134831804 |
| Molecular Formula | C35H49NO15 |
| Molecular Weight | 723.77 g/mol |
| Exact Mass | 723.31 |
| IUPAC Name | [(3S,6S)-6-[(2S,3S,6R)-5-acetamido-2-(phenylmethoxymethyl)-4-prop-2-enoxy-6-propoxyoxan-3-yl]oxy-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
| SMILES | C=CCOC1C(NC(C)=O)[C@H](OCCC)O[C@@H](COCc2ccccc2)[C@H]1O[C@@H]1OC(COC(C)=O)[C@H](OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C35H49NO15/c1-8-15-43-31-28(36-20(3)37)34(44-16-9-2)49-26(18-42-17-25-13-11-10-12-14-25)29(31)51-35-33(48-24(7)41)32(47-23(6)40)30(46-22(5)39)27(50-35)19-45-21(4)38/h8,10-14,26-35H,1,9,15-19H2,2-7H3,(H,36,37)/t26-,27?,28?,29+,30-,31?,32?,33?,34+,35-/m0/s1 |
| InChIKey | DKALRJLEXVVNAV-GYOBXMIKSA-N |
| XLogP | 1.90 |
| TPSA | 189.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.77 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|