C10H13BrO4 — CID 134831862
methyl (5S,6S)-6-acetyloxy-5-bromocyclohexene-1-carboxylate (PubChem CID 134831862) has the molecular formula C10H13BrO4 and a molecular weight of 277.11 g/mol. Its IUPAC name is methyl (5S,6S)-6-acetyloxy-5-bromocyclohexene-1-carboxylate.
| Compound Name | methyl (5S,6S)-6-acetyloxy-5-bromocyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 134831862 |
| Molecular Formula | C10H13BrO4 |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | methyl (5S,6S)-6-acetyloxy-5-bromocyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=CCC[C@H](Br)[C@H]1OC(C)=O |
| InChI | InChI=1S/C10H13BrO4/c1-6(12)15-9-7(10(13)14-2)4-3-5-8(9)11/h4,8-9H,3,5H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | VICDTHGKNFYNSY-IUCAKERBSA-N |
| XLogP | 1.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|