About (4S,5R)-4-methoxy-2-methylhexane-1,5-diol
(4S,5R)-4-methoxy-2-methylhexane-1,5-diol (PubChem CID 134831898) has the molecular formula C8H18O3
and a molecular weight of 162.23 g/mol. Its IUPAC name is (4S,5R)-4-methoxy-2-methylhexane-1,5-diol.
Molecular Properties
| Compound Name | (4S,5R)-4-methoxy-2-methylhexane-1,5-diol |
| PubChem CID | 134831898 |
| Molecular Formula | C8H18O3 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | (4S,5R)-4-methoxy-2-methylhexane-1,5-diol |
| SMILES | CO[C@@H](CC(C)CO)[C@@H](C)O |
| InChI | InChI=1S/C8H18O3/c1-6(5-9)4-8(11-3)7(2)10/h6-10H,4-5H2,1-3H3/t6?,7-,8+/m1/s1 |
| InChIKey | UBPFLRUSJUFDHB-VVXQKDJTSA-N |
| XLogP | 0.40 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S,5R)-4-methoxy-2-methylhexane-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5R)-4-methoxy-2-methylhexane-1,5-diol?
The IUPAC name of (4S,5R)-4-methoxy-2-methylhexane-1,5-diol (CID 134831898) is (4S,5R)-4-methoxy-2-methylhexane-1,5-diol.
What is the SMILES notation for (4S,5R)-4-methoxy-2-methylhexane-1,5-diol?
The canonical SMILES for (4S,5R)-4-methoxy-2-methylhexane-1,5-diol is CO[C@@H](CC(C)CO)[C@@H](C)O.
What is the InChIKey of (4S,5R)-4-methoxy-2-methylhexane-1,5-diol?
The InChIKey is UBPFLRUSJUFDHB-VVXQKDJTSA-N. The full InChI is InChI=1S/C8H18O3/c1-6(5-9)4-8(11-3)7(2)10/h6-10H,4-5H2,1-3H3/t6?,7-,8+/m1/s1.
What are the key properties of (4S,5R)-4-methoxy-2-methylhexane-1,5-diol?
(4S,5R)-4-methoxy-2-methylhexane-1,5-diol has a molecular weight of 162.23 g/mol, XLogP of 0.40, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5R)-4-methoxy-2-methylhexane-1,5-diol is sourced from PubChem (CID 134831898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).