C27H41NO5 — CID 134831934
tert-butyl N-[(3E,4E)-7-ethyl-6-hydroxy-3-[3-[(4-methoxyphenyl)methoxy]propylidene]nona-4,8-dienyl]carbamate (PubChem CID 134831934) has the molecular formula C27H41NO5 and a molecular weight of 459.63 g/mol. Its IUPAC name is tert-butyl N-[(3E,4E)-7-ethyl-6-hydroxy-3-[3-[(4-methoxyphenyl)methoxy]propylidene]nona-4,8-dienyl]carbamate.
| Compound Name | tert-butyl N-[(3E,4E)-7-ethyl-6-hydroxy-3-[3-[(4-methoxyphenyl)methoxy]propylidene]nona-4,8-dienyl]carbamate |
|---|---|
| PubChem CID | 134831934 |
| Molecular Formula | C27H41NO5 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.30 |
| IUPAC Name | tert-butyl N-[(3E,4E)-7-ethyl-6-hydroxy-3-[3-[(4-methoxyphenyl)methoxy]propylidene]nona-4,8-dienyl]carbamate |
| SMILES | C=CC(CC)C(O)/C=C/C(=C/CCOCc1ccc(OC)cc1)CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H41NO5/c1-7-23(8-2)25(29)16-13-21(17-18-28-26(30)33-27(3,4)5)10-9-19-32-20-22-11-14-24(31-6)15-12-22/h7,10-16,23,25,29H,1,8-9,17-20H2,2-6H3,(H,28,30)/b16-13+,21-10- |
| InChIKey | FNTZCRORICJAQF-ZNRTYINHSA-N |
| XLogP | 5.57 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|