C42H52O7Si — CID 134832051
(2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carbaldehyde (PubChem CID 134832051) has the molecular formula C42H52O7Si and a molecular weight of 696.96 g/mol. Its IUPAC name is (2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carbaldehyde.
| Compound Name | (2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carbaldehyde |
|---|---|
| PubChem CID | 134832051 |
| Molecular Formula | C42H52O7Si |
| Molecular Weight | 696.96 g/mol |
| Exact Mass | 696.35 |
| IUPAC Name | (2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane-2-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]1(C=O)OC(COCc2ccccc2)[C@H](OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C42H52O7Si/c1-41(2,3)50(4,5)48-32-42(31-43)40(47-29-36-24-16-9-17-25-36)39(46-28-35-22-14-8-15-23-35)38(45-27-34-20-12-7-13-21-34)37(49-42)30-44-26-33-18-10-6-11-19-33/h6-25,31,37-40H,26-30,32H2,1-5H3/t37?,38-,39?,40?,42-/m0/s1 |
| InChIKey | JHAKYZIZLZRSPG-YYNFEAFDSA-N |
| XLogP | 8.32 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.96 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|