C22H27NO11 — CID 134832189
[(3R,6S)-3,4,6-triacetyloxy-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl acetate (PubChem CID 134832189) has the molecular formula C22H27NO11 and a molecular weight of 481.45 g/mol. Its IUPAC name is [(3R,6S)-3,4,6-triacetyloxy-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(3R,6S)-3,4,6-triacetyloxy-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134832189 |
| Molecular Formula | C22H27NO11 |
| Molecular Weight | 481.45 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | [(3R,6S)-3,4,6-triacetyloxy-5-(phenylmethoxycarbonylamino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1O[C@@H](OC(C)=O)C(NC(=O)OCc2ccccc2)C(OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H27NO11/c1-12(24)29-11-17-19(31-13(2)25)20(32-14(3)26)18(21(34-17)33-15(4)27)23-22(28)30-10-16-8-6-5-7-9-16/h5-9,17-21H,10-11H2,1-4H3,(H,23,28)/t17?,18?,19-,20?,21+/m0/s1 |
| InChIKey | WFUOWCBLXHATHL-IVEPMCGTSA-N |
| XLogP | 1.00 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.45 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|