C18H23F2NO2 — CID 134832253
tert-butyl N-(2,2-difluoro-1-phenylbut-3-enyl)-N-prop-2-enylcarbamate (PubChem CID 134832253) has the molecular formula C18H23F2NO2 and a molecular weight of 323.38 g/mol. Its IUPAC name is tert-butyl N-(2,2-difluoro-1-phenylbut-3-enyl)-N-prop-2-enylcarbamate.
| Compound Name | tert-butyl N-(2,2-difluoro-1-phenylbut-3-enyl)-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 134832253 |
| Molecular Formula | C18H23F2NO2 |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | tert-butyl N-(2,2-difluoro-1-phenylbut-3-enyl)-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OC(C)(C)C)C(c1ccccc1)C(F)(F)C=C |
| InChI | InChI=1S/C18H23F2NO2/c1-6-13-21(16(22)23-17(3,4)5)15(18(19,20)7-2)14-11-9-8-10-12-14/h6-12,15H,1-2,13H2,3-5H3 |
| InChIKey | HGVSHBABXHLALD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|