C20H29ClO5SSi — CID 134832452
methyl (1R,2R,5R)-2-[1-(benzenesulfonyl)-2-chloroethyl]-5-methyl-1-trimethylsilyloxycyclohex-3-ene-1-carboxylate (PubChem CID 134832452) has the molecular formula C20H29ClO5SSi and a molecular weight of 445.05 g/mol. Its IUPAC name is methyl (1R,2R,5R)-2-[1-(benzenesulfonyl)-2-chloroethyl]-5-methyl-1-trimethylsilyloxycyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (1R,2R,5R)-2-[1-(benzenesulfonyl)-2-chloroethyl]-5-methyl-1-trimethylsilyloxycyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 134832452 |
| Molecular Formula | C20H29ClO5SSi |
| Molecular Weight | 445.05 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | methyl (1R,2R,5R)-2-[1-(benzenesulfonyl)-2-chloroethyl]-5-methyl-1-trimethylsilyloxycyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(O[Si](C)(C)C)C[C@@H](C)C=C[C@H]1C(CCl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H29ClO5SSi/c1-15-11-12-17(20(13-15,19(22)25-2)26-28(3,4)5)18(14-21)27(23,24)16-9-7-6-8-10-16/h6-12,15,17-18H,13-14H2,1-5H3/t15-,17-,18?,20+/m0/s1 |
| InChIKey | RQUWZOLJZOMATL-IJQYIVCCSA-N |
| XLogP | 4.04 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.05 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|