C8H9LiO — CID 134832537
lithium (2S)-2-ethynyl-4-methyl-3,6-dihydro-2H-pyran (PubChem CID 134832537) has the molecular formula C8H9LiO and a molecular weight of 128.10 g/mol. Its IUPAC name is lithium (2S)-2-ethynyl-4-methyl-3,6-dihydro-2H-pyran.
| Compound Name | lithium (2S)-2-ethynyl-4-methyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 134832537 |
| Molecular Formula | C8H9LiO |
| Molecular Weight | 128.10 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | lithium (2S)-2-ethynyl-4-methyl-3,6-dihydro-2H-pyran |
| SMILES | [C-]#C[C@@H]1CC(C)=CCO1.[Li+] |
| InChI | InChI=1S/C8H9O.Li/c1-3-8-6-7(2)4-5-9-8;/h4,8H,5-6H2,2H3;/q-1;+1/t8-;/m1./s1 |
| InChIKey | VNFXEGPOFOFHKE-DDWIOCJRSA-N |
| XLogP | -1.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.10 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|