C12H20N2O3S2 — CID 134832538
[(4S)-2,2-dimethyl-1,3-thiazolidine-4-carbonyl] (4R)-2,2-dimethyl-1,3-thiazolidine-4-carboxylate (PubChem CID 134832538) has the molecular formula C12H20N2O3S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is [(4S)-2,2-dimethyl-1,3-thiazolidine-4-carbonyl] (4R)-2,2-dimethyl-1,3-thiazolidine-4-carboxylate.
| Compound Name | [(4S)-2,2-dimethyl-1,3-thiazolidine-4-carbonyl] (4R)-2,2-dimethyl-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 134832538 |
| Molecular Formula | C12H20N2O3S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | [(4S)-2,2-dimethyl-1,3-thiazolidine-4-carbonyl] (4R)-2,2-dimethyl-1,3-thiazolidine-4-carboxylate |
| SMILES | CC1(C)N[C@H](C(=O)OC(=O)[C@H]2CSC(C)(C)N2)CS1 |
| InChI | InChI=1S/C12H20N2O3S2/c1-11(2)13-7(5-18-11)9(15)17-10(16)8-6-19-12(3,4)14-8/h7-8,13-14H,5-6H2,1-4H3/t7-,8+ |
| InChIKey | ZXFSLEHEMJRDRS-OCAPTIKFSA-N |
| XLogP | 0.94 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|