C17H26O5S — CID 134832694
[(4S,5S)-2,2-dimethyl-5-(2-methylpropyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 134832694) has the molecular formula C17H26O5S and a molecular weight of 342.46 g/mol. Its IUPAC name is [(4S,5S)-2,2-dimethyl-5-(2-methylpropyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(4S,5S)-2,2-dimethyl-5-(2-methylpropyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134832694 |
| Molecular Formula | C17H26O5S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | [(4S,5S)-2,2-dimethyl-5-(2-methylpropyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2OC(C)(C)O[C@H]2CC(C)C)cc1 |
| InChI | InChI=1S/C17H26O5S/c1-12(2)10-15-16(22-17(4,5)21-15)11-20-23(18,19)14-8-6-13(3)7-9-14/h6-9,12,15-16H,10-11H2,1-5H3/t15-,16-/m0/s1 |
| InChIKey | BKBSQFOJJZFFCJ-HOTGVXAUSA-N |
| XLogP | 3.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|