About 3-triethylsilyl-1-trimethylsilylcyclopenta[b]naphthalene-2,4,9-trione
3-triethylsilyl-1-trimethylsilylcyclopenta[b]naphthalene-2,4,9-trione (PubChem CID 134832762) has the molecular formula C22H28O3Si2
and a molecular weight of 396.64 g/mol. Its IUPAC name is 3-triethylsilyl-1-trimethylsilylcyclopenta[b]naphthalene-2,4,9-trione.
Molecular Properties
| Compound Name | 3-triethylsilyl-1-trimethylsilylcyclopenta[b]naphthalene-2,4,9-trione |
| PubChem CID | 134832762 |
| Molecular Formula | C22H28O3Si2 |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 3-triethylsilyl-1-trimethylsilylcyclopenta[b]naphthalene-2,4,9-trione |
| SMILES | CC[Si](CC)(CC)c1c2c(=O)c3ccccc3c(=O)c-2c([Si](C)(C)C)c1=O |
| InChI | InChI=1S/C22H28O3Si2/c1-7-27(8-2,9-3)22-17-16(21(20(22)25)26(4,5)6)18(23)14-12-10-11-13-15(14)19(17)24/h10-13H,7-9H2,1-6H3 |
| InChIKey | GFGAASLTYGUASX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-triethylsilyl-1-trimethylsilylcyclopenta[b]naphthalene-2,4,9-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-triethylsilyl-1-trimethylsilylcyclopenta[b]naphthalene-2,4,9-trione?
The IUPAC name of 3-triethylsilyl-1-trimethylsilylcyclopenta[b]naphthalene-2,4,9-trione (CID 134832762) is 3-triethylsilyl-1-trimethylsilylcyclopenta[b]naphthalene-2,4,9-trione.
What is the SMILES notation for 3-triethylsilyl-1-trimethylsilylcyclopenta[b]naphthalene-2,4,9-trione?
The canonical SMILES for 3-triethylsilyl-1-trimethylsilylcyclopenta[b]naphthalene-2,4,9-trione is CC[Si](CC)(CC)c1c2c(=O)c3ccccc3c(=O)c-2c([Si](C)(C)C)c1=O.
What is the InChIKey of 3-triethylsilyl-1-trimethylsilylcyclopenta[b]naphthalene-2,4,9-trione?
The InChIKey is GFGAASLTYGUASX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28O3Si2/c1-7-27(8-2,9-3)22-17-16(21(20(22)25)26(4,5)6)18(23)14-12-10-11-13-15(14)19(17)24/h10-13H,7-9H2,1-6H3.
What are the key properties of 3-triethylsilyl-1-trimethylsilylcyclopenta[b]naphthalene-2,4,9-trione?
3-triethylsilyl-1-trimethylsilylcyclopenta[b]naphthalene-2,4,9-trione has a molecular weight of 396.64 g/mol, XLogP of 3.16, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-triethylsilyl-1-trimethylsilylcyclopenta[b]naphthalene-2,4,9-trione is sourced from PubChem (CID 134832762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).