C11H12O4 — CID 134832868
methyl (2R,6S,7R)-5-oxo-4-oxatricyclo[5.2.1.02,6]dec-8-ene-2-carboxylate (PubChem CID 134832868) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is methyl (2R,6S,7R)-5-oxo-4-oxatricyclo[5.2.1.02,6]dec-8-ene-2-carboxylate.
| Compound Name | methyl (2R,6S,7R)-5-oxo-4-oxatricyclo[5.2.1.02,6]dec-8-ene-2-carboxylate |
|---|---|
| PubChem CID | 134832868 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | methyl (2R,6S,7R)-5-oxo-4-oxatricyclo[5.2.1.02,6]dec-8-ene-2-carboxylate |
| SMILES | COC(=O)[C@@]12COC(=O)[C@H]1[C@H]1C=CC2C1 |
| InChI | InChI=1S/C11H12O4/c1-14-10(13)11-5-15-9(12)8(11)6-2-3-7(11)4-6/h2-3,6-8H,4-5H2,1H3/t6-,7?,8+,11+/m0/s1 |
| InChIKey | KAYLRVTWUAGVNK-YXNRCHSGSA-N |
| XLogP | 0.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|