About (4E)-5-methyl-8-triethylsilyloxy-2-(trimethylsilylmethyl)octa-1,4-dien-3-ol
(4E)-5-methyl-8-triethylsilyloxy-2-(trimethylsilylmethyl)octa-1,4-dien-3-ol (PubChem CID 134832873) has the molecular formula C19H40O2Si2
and a molecular weight of 356.70 g/mol. Its IUPAC name is (4E)-5-methyl-8-triethylsilyloxy-2-(trimethylsilylmethyl)octa-1,4-dien-3-ol.
Molecular Properties
| Compound Name | (4E)-5-methyl-8-triethylsilyloxy-2-(trimethylsilylmethyl)octa-1,4-dien-3-ol |
| PubChem CID | 134832873 |
| Molecular Formula | C19H40O2Si2 |
| Molecular Weight | 356.70 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | (4E)-5-methyl-8-triethylsilyloxy-2-(trimethylsilylmethyl)octa-1,4-dien-3-ol |
| SMILES | C=C(C[Si](C)(C)C)C(O)/C=C(\C)CCCO[Si](CC)(CC)CC |
| InChI | InChI=1S/C19H40O2Si2/c1-9-23(10-2,11-3)21-14-12-13-17(4)15-19(20)18(5)16-22(6,7)8/h15,19-20H,5,9-14,16H2,1-4,6-8H3/b17-15+ |
| InChIKey | PHLKILKLLJRRCO-BMRADRMJSA-N |
| XLogP | 5.99 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.70 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-5-methyl-8-triethylsilyloxy-2-(trimethylsilylmethyl)octa-1,4-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-5-methyl-8-triethylsilyloxy-2-(trimethylsilylmethyl)octa-1,4-dien-3-ol?
The IUPAC name of (4E)-5-methyl-8-triethylsilyloxy-2-(trimethylsilylmethyl)octa-1,4-dien-3-ol (CID 134832873) is (4E)-5-methyl-8-triethylsilyloxy-2-(trimethylsilylmethyl)octa-1,4-dien-3-ol.
What is the SMILES notation for (4E)-5-methyl-8-triethylsilyloxy-2-(trimethylsilylmethyl)octa-1,4-dien-3-ol?
The canonical SMILES for (4E)-5-methyl-8-triethylsilyloxy-2-(trimethylsilylmethyl)octa-1,4-dien-3-ol is C=C(C[Si](C)(C)C)C(O)/C=C(\C)CCCO[Si](CC)(CC)CC.
What is the InChIKey of (4E)-5-methyl-8-triethylsilyloxy-2-(trimethylsilylmethyl)octa-1,4-dien-3-ol?
The InChIKey is PHLKILKLLJRRCO-BMRADRMJSA-N. The full InChI is InChI=1S/C19H40O2Si2/c1-9-23(10-2,11-3)21-14-12-13-17(4)15-19(20)18(5)16-22(6,7)8/h15,19-20H,5,9-14,16H2,1-4,6-8H3/b17-15+.
What are the key properties of (4E)-5-methyl-8-triethylsilyloxy-2-(trimethylsilylmethyl)octa-1,4-dien-3-ol?
(4E)-5-methyl-8-triethylsilyloxy-2-(trimethylsilylmethyl)octa-1,4-dien-3-ol has a molecular weight of 356.70 g/mol, XLogP of 5.99, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-5-methyl-8-triethylsilyloxy-2-(trimethylsilylmethyl)octa-1,4-dien-3-ol is sourced from PubChem (CID 134832873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).