About [(1R,2S)-3,3-bis(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol
[(1R,2S)-3,3-bis(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol (PubChem CID 134832922) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is [(1R,2S)-3,3-bis(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol.
Molecular Properties
| Compound Name | [(1R,2S)-3,3-bis(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol |
| PubChem CID | 134832922 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | [(1R,2S)-3,3-bis(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol |
| SMILES | OC[C@H]1[C@H]2C=CC(C2)C1(CO)CO |
| InChI | InChI=1S/C10H16O3/c11-4-9-7-1-2-8(3-7)10(9,5-12)6-13/h1-2,7-9,11-13H,3-6H2/t7-,8?,9-/m0/s1 |
| InChIKey | MHJBCSZQFAWXLR-SMOXQLQSSA-N |
| XLogP | -0.23 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2S)-3,3-bis(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-3,3-bis(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol?
The IUPAC name of [(1R,2S)-3,3-bis(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol (CID 134832922) is [(1R,2S)-3,3-bis(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol.
What is the SMILES notation for [(1R,2S)-3,3-bis(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol?
The canonical SMILES for [(1R,2S)-3,3-bis(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol is OC[C@H]1[C@H]2C=CC(C2)C1(CO)CO.
What is the InChIKey of [(1R,2S)-3,3-bis(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol?
The InChIKey is MHJBCSZQFAWXLR-SMOXQLQSSA-N. The full InChI is InChI=1S/C10H16O3/c11-4-9-7-1-2-8(3-7)10(9,5-12)6-13/h1-2,7-9,11-13H,3-6H2/t7-,8?,9-/m0/s1.
What are the key properties of [(1R,2S)-3,3-bis(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol?
[(1R,2S)-3,3-bis(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol has a molecular weight of 184.23 g/mol, XLogP of -0.23, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-3,3-bis(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol is sourced from PubChem (CID 134832922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).