C14H19NO2 — CID 134832957
2-[(1'R,2'S)-2,2-dimethylspiro[1,3-dioxane-5,3'-bicyclo[2.2.1]hept-5-ene]-2'-yl]acetonitrile (PubChem CID 134832957) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-[(1'R,2'S)-2,2-dimethylspiro[1,3-dioxane-5,3'-bicyclo[2.2.1]hept-5-ene]-2'-yl]acetonitrile.
| Compound Name | 2-[(1'R,2'S)-2,2-dimethylspiro[1,3-dioxane-5,3'-bicyclo[2.2.1]hept-5-ene]-2'-yl]acetonitrile |
|---|---|
| PubChem CID | 134832957 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 2-[(1'R,2'S)-2,2-dimethylspiro[1,3-dioxane-5,3'-bicyclo[2.2.1]hept-5-ene]-2'-yl]acetonitrile |
| SMILES | CC1(C)OCC2(CO1)C1C=C[C@@H](C1)[C@@H]2CC#N |
| InChI | InChI=1S/C14H19NO2/c1-13(2)16-8-14(9-17-13)11-4-3-10(7-11)12(14)5-6-15/h3-4,10-12H,5,7-9H2,1-2H3/t10-,11?,12-/m0/s1 |
| InChIKey | VOEVQISKZGKGCX-PRWSFJOGSA-N |
| XLogP | 2.49 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|