C13H20O3 — CID 134833000
[(1'R,2'S)-2,2-dimethylspiro[1,3-dioxane-5,3'-bicyclo[2.2.1]hept-5-ene]-2'-yl]methanol (PubChem CID 134833000) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is [(1'R,2'S)-2,2-dimethylspiro[1,3-dioxane-5,3'-bicyclo[2.2.1]hept-5-ene]-2'-yl]methanol.
| Compound Name | [(1'R,2'S)-2,2-dimethylspiro[1,3-dioxane-5,3'-bicyclo[2.2.1]hept-5-ene]-2'-yl]methanol |
|---|---|
| PubChem CID | 134833000 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | [(1'R,2'S)-2,2-dimethylspiro[1,3-dioxane-5,3'-bicyclo[2.2.1]hept-5-ene]-2'-yl]methanol |
| SMILES | CC1(C)OCC2(CO1)C1C=C[C@@H](C1)[C@@H]2CO |
| InChI | InChI=1S/C13H20O3/c1-12(2)15-7-13(8-16-12)10-4-3-9(5-10)11(13)6-14/h3-4,9-11,14H,5-8H2,1-2H3/t9-,10?,11-/m0/s1 |
| InChIKey | CIGXJMGDJYYICI-JRUYECLLSA-N |
| XLogP | 1.57 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|