C15H20O5 — CID 134833134
(3R,3aS,6R,6aR)-2-methoxy-3a-phenylmethoxy-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3,6-diol (PubChem CID 134833134) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (3R,3aS,6R,6aR)-2-methoxy-3a-phenylmethoxy-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3,6-diol.
| Compound Name | (3R,3aS,6R,6aR)-2-methoxy-3a-phenylmethoxy-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3,6-diol |
|---|---|
| PubChem CID | 134833134 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (3R,3aS,6R,6aR)-2-methoxy-3a-phenylmethoxy-2,3,4,5,6,6a-hexahydrocyclopenta[b]furan-3,6-diol |
| SMILES | COC1O[C@@H]2[C@H](O)CC[C@]2(OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C15H20O5/c1-18-14-12(17)15(8-7-11(16)13(15)20-14)19-9-10-5-3-2-4-6-10/h2-6,11-14,16-17H,7-9H2,1H3/t11-,12+,13-,14?,15+/m1/s1 |
| InChIKey | SYLRZTUEWNEACS-LJIAPDMLSA-N |
| XLogP | 0.83 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |